Latest revision | Your text |
description / nds | description / nds |
| cheemsch Verbinnen
|
description / tr | description / tr |
| kimyasal bileşik
|
Property / PubChem CID: 5460769 / reference | |
| | |
Property / instance of | |
| | |
Property / instance of: type of chemical entity / rank | |
| Normal rank
| |
Property / ChEBI ID: 3139 / reference | |
| matched by identifier from: International Chemical Identifier InChI: InChI=1S/C55H83N17O21S3/c1-20-33(69-46(72-44(20)58)25(12-31(57)76)64-13-24(56)45(59)82)50(86)71-35(41(26-14-61-19-65-26)91-54-43(39(80)37(78)29(15-73)90-54)92-53-40(81)42(93-55(60)88)38(79)30(16-74)89-53)51(87)66-22(3)36(77)21(2)47(83)70-34(23(4)75)49(85)63-10-8-32-67-28(18-94-32)52-68-27(17-95-52)48(84)62-9-7-11-96(5)6/h14,17-19,21-25,29-30,34-43,53-54,64,73-75,77-81H,7-13,15-16,56H2,1-6H3,(H13-,57,58,59,60,61,62,63,65,66,69,70,71,72,76,82,83,84,85,86,87,88)/p+1/t21-,22+,23+,24-,25-,29-,30+,34-,35-,36-,37+,38+,39-,40-,41-,42-,43-,53+,54-/m0/s1 | |
Property / DSSTox substance ID: DTXSID20872327 / reference | |
| | |
Property / subclass of | |
| | |
Property / subclass of: thiazole alkaloid / rank | |
| Normal rank
| |
Property / subclass of | |
| | |
Property / subclass of: bleomycins / rank | |
| Normal rank
| |
Property / UniChem compound ID | |
| | |
Property / UniChem compound ID: 329739 / rank | |
| Normal rank
| |
Property / UniChem compound ID: 329739 / reference | |
| | |
Property / chemical formula | |
| C₅₅H₈₄N₁₇O₂₁S₃⁺
| |
Property / chemical formula: C₅₅H₈₄N₁₇O₂₁S₃⁺ / rank | |
| Normal rank
| |
Property / chemical formula: C₅₅H₈₄N₁₇O₂₁S₃⁺ / reference | |
| | |
Property / Natural Product Atlas ID | |
| | |
Property / Natural Product Atlas ID: NPA020036 / rank | |
| Normal rank
| |
Property / Natural Product Atlas ID: NPA020036 / reference | |
| | |
Property / Natural Product Atlas ID: NPA020036 / reference | |
| | |
Property / SureChEMBL ID | |
| | |
Property / SureChEMBL ID: SCHEMBL134155 / rank | |
| Normal rank
| |
Property / SureChEMBL ID: SCHEMBL134155 / reference | |
| | |
Property / SureChEMBL ID: SCHEMBL134155 / reference | |
| | |
| Property / instance of |
| | |
| Property / instance of: chemical compound / rank |
| | Normal rank |
| Property / instance of: chemical compound / reference |
| | |
| Property / instance of |
| | |
| Property / instance of: bleomycins / rank |
| | Normal rank |
| Property / instance of |
| | |
| Property / instance of: thiazole alkaloid / rank |
| | Normal rank |
| Property / instance of: thiazole alkaloid / reference |
| | |
| Property / chemical formula |
| | C₅₅H₈₄N₁₇O₂₁S₃+ |
| Property / chemical formula: C₅₅H₈₄N₁₇O₂₁S₃+ / rank |
| | Normal rank |
| Property / chemical formula: C₅₅H₈₄N₁₇O₂₁S₃+ / reference |
| | |